C14H17NO2S — CID 54429765
1-(1-phenylpropylsulfanylmethyl)pyrrole-2,5-diol (PubChem CID 54429765) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is 1-(1-phenylpropylsulfanylmethyl)pyrrole-2,5-diol.
| Compound Name | 1-(1-phenylpropylsulfanylmethyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 54429765 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 1-(1-phenylpropylsulfanylmethyl)pyrrole-2,5-diol |
| SMILES | CCC(SCn1c(O)ccc1O)c1ccccc1 |
| InChI | InChI=1S/C14H17NO2S/c1-2-12(11-6-4-3-5-7-11)18-10-15-13(16)8-9-14(15)17/h3-9,12,16-17H,2,10H2,1H3 |
| InChIKey | WGQLTTNJSWXWKB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |