C9H11NO2 — CID 54430110
2-methyl-4,7-dihydroisoindole-1,3-diol (PubChem CID 54430110) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 2-methyl-4,7-dihydroisoindole-1,3-diol.
| Compound Name | 2-methyl-4,7-dihydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 54430110 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 2-methyl-4,7-dihydroisoindole-1,3-diol |
| SMILES | Cn1c(O)c2c(c1O)CC=CC2 |
| InChI | InChI=1S/C9H11NO2/c1-10-8(11)6-4-2-3-5-7(6)9(10)12/h2-3,11-12H,4-5H2,1H3 |
| InChIKey | WGWUSIVQUAGHSS-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|