About (3-methoxy-3-oxopropyl) 2-formyloxypentanoate
(3-methoxy-3-oxopropyl) 2-formyloxypentanoate (PubChem CID 54434266) has the molecular formula C10H16O6
and a molecular weight of 232.23 g/mol. Its IUPAC name is (3-methoxy-3-oxopropyl) 2-formyloxypentanoate.
Molecular Properties
| Compound Name | (3-methoxy-3-oxopropyl) 2-formyloxypentanoate |
| PubChem CID | 54434266 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | (3-methoxy-3-oxopropyl) 2-formyloxypentanoate |
| SMILES | CCCC(OC=O)C(=O)OCCC(=O)OC |
| InChI | InChI=1S/C10H16O6/c1-3-4-8(16-7-11)10(13)15-6-5-9(12)14-2/h7-8H,3-6H2,1-2H3 |
| InChIKey | KUQNWNMLWWUTFC-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3-methoxy-3-oxopropyl) 2-formyloxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxy-3-oxopropyl) 2-formyloxypentanoate?
The IUPAC name of (3-methoxy-3-oxopropyl) 2-formyloxypentanoate (CID 54434266) is (3-methoxy-3-oxopropyl) 2-formyloxypentanoate.
What is the SMILES notation for (3-methoxy-3-oxopropyl) 2-formyloxypentanoate?
The canonical SMILES for (3-methoxy-3-oxopropyl) 2-formyloxypentanoate is CCCC(OC=O)C(=O)OCCC(=O)OC.
What is the InChIKey of (3-methoxy-3-oxopropyl) 2-formyloxypentanoate?
The InChIKey is KUQNWNMLWWUTFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O6/c1-3-4-8(16-7-11)10(13)15-6-5-9(12)14-2/h7-8H,3-6H2,1-2H3.
What are the key properties of (3-methoxy-3-oxopropyl) 2-formyloxypentanoate?
(3-methoxy-3-oxopropyl) 2-formyloxypentanoate has a molecular weight of 232.23 g/mol, XLogP of 0.43, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxy-3-oxopropyl) 2-formyloxypentanoate is sourced from PubChem (CID 54434266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).