About oxan-2-ylthiourea
oxan-2-ylthiourea (PubChem CID 54435172) has the molecular formula C6H12N2OS
and a molecular weight of 160.24 g/mol. Its IUPAC name is oxan-2-ylthiourea.
Molecular Properties
| Compound Name | oxan-2-ylthiourea |
| PubChem CID | 54435172 |
| Molecular Formula | C6H12N2OS |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | oxan-2-ylthiourea |
| SMILES | NC(=S)NC1CCCCO1 |
| InChI | InChI=1S/C6H12N2OS/c7-6(10)8-5-3-1-2-4-9-5/h5H,1-4H2,(H3,7,8,10) |
| InChIKey | RRBVKPQLHBIUFP-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze oxan-2-ylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-2-ylthiourea?
The IUPAC name of oxan-2-ylthiourea (CID 54435172) is oxan-2-ylthiourea.
What is the SMILES notation for oxan-2-ylthiourea?
The canonical SMILES for oxan-2-ylthiourea is NC(=S)NC1CCCCO1.
What is the InChIKey of oxan-2-ylthiourea?
The InChIKey is RRBVKPQLHBIUFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2OS/c7-6(10)8-5-3-1-2-4-9-5/h5H,1-4H2,(H3,7,8,10).
What are the key properties of oxan-2-ylthiourea?
oxan-2-ylthiourea has a molecular weight of 160.24 g/mol, XLogP of 0.35, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-2-ylthiourea is sourced from PubChem (CID 54435172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).