C11H16NO3P — CID 54459364
(4-amino-2-phenylpent-2-enyl)phosphonic acid (PubChem CID 54459364) has the molecular formula C11H16NO3P and a molecular weight of 241.23 g/mol. Its IUPAC name is (4-amino-2-phenylpent-2-enyl)phosphonic acid.
| Compound Name | (4-amino-2-phenylpent-2-enyl)phosphonic acid |
|---|---|
| PubChem CID | 54459364 |
| Molecular Formula | C11H16NO3P |
| Molecular Weight | 241.23 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | (4-amino-2-phenylpent-2-enyl)phosphonic acid |
| SMILES | CC(N)C=C(CP(=O)(O)O)c1ccccc1 |
| InChI | InChI=1S/C11H16NO3P/c1-9(12)7-11(8-16(13,14)15)10-5-3-2-4-6-10/h2-7,9H,8,12H2,1H3,(H2,13,14,15) |
| InChIKey | XANDZRMODSVIFY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|