C20H29Cl2N3O4 — CID 54467323
tert-butyl N-[2-[[(2S)-2-[bis(2-chloroethyl)amino]-3-phenylpropanoyl]amino]-2-oxoethyl]carbamate (PubChem CID 54467323) has the molecular formula C20H29Cl2N3O4 and a molecular weight of 446.38 g/mol. Its IUPAC name is tert-butyl N-[2-[[(2S)-2-[bis(2-chloroethyl)amino]-3-phenylpropanoyl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(2S)-2-[bis(2-chloroethyl)amino]-3-phenylpropanoyl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 54467323 |
| Molecular Formula | C20H29Cl2N3O4 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | tert-butyl N-[2-[[(2S)-2-[bis(2-chloroethyl)amino]-3-phenylpropanoyl]amino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NC(=O)[C@H](Cc1ccccc1)N(CCCl)CCCl |
| InChI | InChI=1S/C20H29Cl2N3O4/c1-20(2,3)29-19(28)23-14-17(26)24-18(27)16(25(11-9-21)12-10-22)13-15-7-5-4-6-8-15/h4-8,16H,9-14H2,1-3H3,(H,23,28)(H,24,26,27)/t16-/m0/s1 |
| InChIKey | XFVLKHZAHOHGFH-INIZCTEOSA-N |
| XLogP | 2.54 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|