C23H27Cl2N3O4 — CID 54223365
benzyl N-[2-[[(2S)-2-[bis(2-chloroethyl)amino]-3-phenylpropanoyl]amino]-2-oxoethyl]carbamate (PubChem CID 54223365) has the molecular formula C23H27Cl2N3O4 and a molecular weight of 480.39 g/mol. Its IUPAC name is benzyl N-[2-[[(2S)-2-[bis(2-chloroethyl)amino]-3-phenylpropanoyl]amino]-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[2-[[(2S)-2-[bis(2-chloroethyl)amino]-3-phenylpropanoyl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 54223365 |
| Molecular Formula | C23H27Cl2N3O4 |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | benzyl N-[2-[[(2S)-2-[bis(2-chloroethyl)amino]-3-phenylpropanoyl]amino]-2-oxoethyl]carbamate |
| SMILES | O=C(CNC(=O)OCc1ccccc1)NC(=O)[C@H](Cc1ccccc1)N(CCCl)CCCl |
| InChI | InChI=1S/C23H27Cl2N3O4/c24-11-13-28(14-12-25)20(15-18-7-3-1-4-8-18)22(30)27-21(29)16-26-23(31)32-17-19-9-5-2-6-10-19/h1-10,20H,11-17H2,(H,26,31)(H,27,29,30)/t20-/m0/s1 |
| InChIKey | QEDYKHZJNOQADQ-FQEVSTJZSA-N |
| XLogP | 2.95 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|