C22H33NO — CID 54467544
(2R,4aR)-6-pentyl-N-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxamide (PubChem CID 54467544) has the molecular formula C22H33NO and a molecular weight of 327.51 g/mol. Its IUPAC name is (2R,4aR)-6-pentyl-N-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxamide.
| Compound Name | (2R,4aR)-6-pentyl-N-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 54467544 |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | (2R,4aR)-6-pentyl-N-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxamide |
| SMILES | CCCCCC1CCC2C[C@H](C(=O)Nc3ccccc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C22H33NO/c1-2-3-5-8-17-11-12-19-16-20(14-13-18(19)15-17)22(24)23-21-9-6-4-7-10-21/h4,6-7,9-10,17-20H,2-3,5,8,11-16H2,1H3,(H,23,24)/t17?,18-,19?,20-/m1/s1 |
| InChIKey | XFZHPIXVMBLKOE-CQJJOKNBSA-N |
| XLogP | 6.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|