C11H18O6P2S — CID 54467976
[(2,3-diethylphenyl)sulfanyl-phosphonomethyl]phosphonic acid (PubChem CID 54467976) has the molecular formula C11H18O6P2S and a molecular weight of 340.27 g/mol. Its IUPAC name is [(2,3-diethylphenyl)sulfanyl-phosphonomethyl]phosphonic acid.
| Compound Name | [(2,3-diethylphenyl)sulfanyl-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 54467976 |
| Molecular Formula | C11H18O6P2S |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | [(2,3-diethylphenyl)sulfanyl-phosphonomethyl]phosphonic acid |
| SMILES | CCc1cccc(SC(P(=O)(O)O)P(=O)(O)O)c1CC |
| InChI | InChI=1S/C11H18O6P2S/c1-3-8-6-5-7-10(9(8)4-2)20-11(18(12,13)14)19(15,16)17/h5-7,11H,3-4H2,1-2H3,(H2,12,13,14)(H2,15,16,17) |
| InChIKey | XGHQCOJNQZSGGD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|