C24H35N4O8P — CID 54472480
2-[[methoxy-[(4-nitro-1,3-dioxoisoindol-2-yl)methyl]phosphoryl]methyl]-4-methyl-N-[4-methyl-1-(methylamino)-1-oxopentan-2-yl]pentanamide (PubChem CID 54472480) has the molecular formula C24H35N4O8P and a molecular weight of 538.54 g/mol. Its IUPAC name is 2-[[methoxy-[(4-nitro-1,3-dioxoisoindol-2-yl)methyl]phosphoryl]methyl]-4-methyl-N-[4-methyl-1-(methylamino)-1-oxopentan-2-yl]pentanamide.
| Compound Name | 2-[[methoxy-[(4-nitro-1,3-dioxoisoindol-2-yl)methyl]phosphoryl]methyl]-4-methyl-N-[4-methyl-1-(methylamino)-1-oxopentan-2-yl]pentanamide |
|---|---|
| PubChem CID | 54472480 |
| Molecular Formula | C24H35N4O8P |
| Molecular Weight | 538.54 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | 2-[[methoxy-[(4-nitro-1,3-dioxoisoindol-2-yl)methyl]phosphoryl]methyl]-4-methyl-N-[4-methyl-1-(methylamino)-1-oxopentan-2-yl]pentanamide |
| SMILES | CNC(=O)C(CC(C)C)NC(=O)C(CC(C)C)CP(=O)(CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)OC |
| InChI | InChI=1S/C24H35N4O8P/c1-14(2)10-16(21(29)26-18(11-15(3)4)22(30)25-5)12-37(35,36-6)13-27-23(31)17-8-7-9-19(28(33)34)20(17)24(27)32/h7-9,14-16,18H,10-13H2,1-6H3,(H,25,30)(H,26,29) |
| InChIKey | XJHHODISGXBDLX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 165.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.54 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|