C27H30N4O5S — CID 54474938
methyl 3-[(2S)-3-(4-carbamimidoylphenyl)-2-(naphthalen-2-ylsulfonylamino)propanoyl]piperidine-3-carboxylate (PubChem CID 54474938) has the molecular formula C27H30N4O5S and a molecular weight of 522.63 g/mol. Its IUPAC name is methyl 3-[(2S)-3-(4-carbamimidoylphenyl)-2-(naphthalen-2-ylsulfonylamino)propanoyl]piperidine-3-carboxylate.
| Compound Name | methyl 3-[(2S)-3-(4-carbamimidoylphenyl)-2-(naphthalen-2-ylsulfonylamino)propanoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 54474938 |
| Molecular Formula | C27H30N4O5S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | methyl 3-[(2S)-3-(4-carbamimidoylphenyl)-2-(naphthalen-2-ylsulfonylamino)propanoyl]piperidine-3-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(C[C@H](NS(=O)(=O)c2ccc3ccccc3c2)C(=O)C2(C(=O)OC)CCCNC2)cc1 |
| InChI | InChI=1S/C27H30N4O5S/c1-36-26(33)27(13-4-14-30-17-27)24(32)23(15-18-7-9-20(10-8-18)25(28)29)31-37(34,35)22-12-11-19-5-2-3-6-21(19)16-22/h2-3,5-12,16,23,30-31H,4,13-15,17H2,1H3,(H3,28,29)/t23-,27?/m0/s1 |
| InChIKey | XKXGKSQHOUJCGL-DCCUJTHKSA-N |
| XLogP | 2.13 |
| TPSA | 151.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|