C32H33ClN2O5 — CID 54481424
methyl 2-benzyl-3-[2-butyl-5-chloro-3-[[4-(3,4-dioxo-2-propan-2-yloxycyclobuten-1-yl)phenyl]methyl]imidazol-4-yl]prop-2-enoate (PubChem CID 54481424) has the molecular formula C32H33ClN2O5 and a molecular weight of 561.08 g/mol. Its IUPAC name is methyl 2-benzyl-3-[2-butyl-5-chloro-3-[[4-(3,4-dioxo-2-propan-2-yloxycyclobuten-1-yl)phenyl]methyl]imidazol-4-yl]prop-2-enoate.
| Compound Name | methyl 2-benzyl-3-[2-butyl-5-chloro-3-[[4-(3,4-dioxo-2-propan-2-yloxycyclobuten-1-yl)phenyl]methyl]imidazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 54481424 |
| Molecular Formula | C32H33ClN2O5 |
| Molecular Weight | 561.08 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | methyl 2-benzyl-3-[2-butyl-5-chloro-3-[[4-(3,4-dioxo-2-propan-2-yloxycyclobuten-1-yl)phenyl]methyl]imidazol-4-yl]prop-2-enoate |
| SMILES | CCCCc1nc(Cl)c(C=C(Cc2ccccc2)C(=O)OC)n1Cc1ccc(-c2c(OC(C)C)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C32H33ClN2O5/c1-5-6-12-26-34-31(33)25(18-24(32(38)39-4)17-21-10-8-7-9-11-21)35(26)19-22-13-15-23(16-14-22)27-28(36)29(37)30(27)40-20(2)3/h7-11,13-16,18,20H,5-6,12,17,19H2,1-4H3 |
| InChIKey | XPGCMFHLJMHBSQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.08 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|