C26H21N3O6 — CID 54482489
3-(4-hydroxy-3,5-dimethoxyphenyl)-N-(6-nitro-4-phenylquinolin-3-yl)prop-2-enamide (PubChem CID 54482489) has the molecular formula C26H21N3O6 and a molecular weight of 471.47 g/mol. Its IUPAC name is 3-(4-hydroxy-3,5-dimethoxyphenyl)-N-(6-nitro-4-phenylquinolin-3-yl)prop-2-enamide.
| Compound Name | 3-(4-hydroxy-3,5-dimethoxyphenyl)-N-(6-nitro-4-phenylquinolin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 54482489 |
| Molecular Formula | C26H21N3O6 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 3-(4-hydroxy-3,5-dimethoxyphenyl)-N-(6-nitro-4-phenylquinolin-3-yl)prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2cnc3ccc([N+](=O)[O-])cc3c2-c2ccccc2)cc(OC)c1O |
| InChI | InChI=1S/C26H21N3O6/c1-34-22-12-16(13-23(35-2)26(22)31)8-11-24(30)28-21-15-27-20-10-9-18(29(32)33)14-19(20)25(21)17-6-4-3-5-7-17/h3-15,31H,1-2H3,(H,28,30) |
| InChIKey | XPZXIMFDXJRBOC-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 123.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|