C28H25ClN2O4 — CID 22403889
(E)-N-[4-(2-chlorophenyl)-6,8-dimethylquinolin-3-yl]-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enamide (PubChem CID 22403889) has the molecular formula C28H25ClN2O4 and a molecular weight of 488.97 g/mol. Its IUPAC name is (E)-N-[4-(2-chlorophenyl)-6,8-dimethylquinolin-3-yl]-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(2-chlorophenyl)-6,8-dimethylquinolin-3-yl]-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 22403889 |
| Molecular Formula | C28H25ClN2O4 |
| Molecular Weight | 488.97 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | (E)-N-[4-(2-chlorophenyl)-6,8-dimethylquinolin-3-yl]-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2cnc3c(C)cc(C)cc3c2-c2ccccc2Cl)cc(OC)c1O |
| InChI | InChI=1S/C28H25ClN2O4/c1-16-11-17(2)27-20(12-16)26(19-7-5-6-8-21(19)29)22(15-30-27)31-25(32)10-9-18-13-23(34-3)28(33)24(14-18)35-4/h5-15,33H,1-4H3,(H,31,32)/b10-9+ |
| InChIKey | FSJGAXXOCVNXEO-MDZDMXLPSA-N |
| XLogP | 6.55 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.97 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|