C30H31ClN2O4 — CID 160780582
N-[4-(2-chlorophenyl)-6,8-dimethylquinolin-3-yl]-3-(3,4-dimethoxyphenyl)prop-2-enamide;ethanol (PubChem CID 160780582) has the molecular formula C30H31ClN2O4 and a molecular weight of 519.04 g/mol. Its IUPAC name is N-[4-(2-chlorophenyl)-6,8-dimethylquinolin-3-yl]-3-(3,4-dimethoxyphenyl)prop-2-enamide;ethanol.
| Compound Name | N-[4-(2-chlorophenyl)-6,8-dimethylquinolin-3-yl]-3-(3,4-dimethoxyphenyl)prop-2-enamide;ethanol |
|---|---|
| PubChem CID | 160780582 |
| Molecular Formula | C30H31ClN2O4 |
| Molecular Weight | 519.04 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | N-[4-(2-chlorophenyl)-6,8-dimethylquinolin-3-yl]-3-(3,4-dimethoxyphenyl)prop-2-enamide;ethanol |
| SMILES | CCO.COc1ccc(C=CC(=O)Nc2cnc3c(C)cc(C)cc3c2-c2ccccc2Cl)cc1OC |
| InChI | InChI=1S/C28H25ClN2O3.C2H6O/c1-17-13-18(2)28-21(14-17)27(20-7-5-6-8-22(20)29)23(16-30-28)31-26(32)12-10-19-9-11-24(33-3)25(15-19)34-4;1-2-3/h5-16H,1-4H3,(H,31,32);3H,2H2,1H3 |
| InChIKey | SANFMVKDDLSYMA-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.04 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|