C26H23ClN2O3 — CID 22403855
N-[4-(2-chlorophenyl)-6,8-dimethylquinolin-3-yl]-3-(2,3-dihydroxyphenyl)propanamide (PubChem CID 22403855) has the molecular formula C26H23ClN2O3 and a molecular weight of 446.93 g/mol. Its IUPAC name is N-[4-(2-chlorophenyl)-6,8-dimethylquinolin-3-yl]-3-(2,3-dihydroxyphenyl)propanamide.
| Compound Name | N-[4-(2-chlorophenyl)-6,8-dimethylquinolin-3-yl]-3-(2,3-dihydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 22403855 |
| Molecular Formula | C26H23ClN2O3 |
| Molecular Weight | 446.93 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | N-[4-(2-chlorophenyl)-6,8-dimethylquinolin-3-yl]-3-(2,3-dihydroxyphenyl)propanamide |
| SMILES | Cc1cc(C)c2ncc(NC(=O)CCc3cccc(O)c3O)c(-c3ccccc3Cl)c2c1 |
| InChI | InChI=1S/C26H23ClN2O3/c1-15-12-16(2)25-19(13-15)24(18-7-3-4-8-20(18)27)21(14-28-25)29-23(31)11-10-17-6-5-9-22(30)26(17)32/h3-9,12-14,30,32H,10-11H2,1-2H3,(H,29,31) |
| InChIKey | GGYYWYMPNNHOMM-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.93 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|