C25H24ClNO — CID 54486785
1-(4-chlorophenyl)-1-cyclopropylidene-N-[(2,4-dimethyl-3-phenylphenyl)methoxy]methanamine (PubChem CID 54486785) has the molecular formula C25H24ClNO and a molecular weight of 389.93 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-1-cyclopropylidene-N-[(2,4-dimethyl-3-phenylphenyl)methoxy]methanamine.
| Compound Name | 1-(4-chlorophenyl)-1-cyclopropylidene-N-[(2,4-dimethyl-3-phenylphenyl)methoxy]methanamine |
|---|---|
| PubChem CID | 54486785 |
| Molecular Formula | C25H24ClNO |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 1-(4-chlorophenyl)-1-cyclopropylidene-N-[(2,4-dimethyl-3-phenylphenyl)methoxy]methanamine |
| SMILES | Cc1ccc(CONC(=C2CC2)c2ccc(Cl)cc2)c(C)c1-c1ccccc1 |
| InChI | InChI=1S/C25H24ClNO/c1-17-8-9-22(18(2)24(17)19-6-4-3-5-7-19)16-28-27-25(20-10-11-20)21-12-14-23(26)15-13-21/h3-9,12-15,27H,10-11,16H2,1-2H3 |
| InChIKey | XSWKGVRWKQDWPY-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|