C21H26N2O2S — CID 54490139
3-(3,5-ditert-butyl-4-hydroxybenzoyl)-1-methyl-4-sulfanylpyrrole-2-carbonitrile (PubChem CID 54490139) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxybenzoyl)-1-methyl-4-sulfanylpyrrole-2-carbonitrile.
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxybenzoyl)-1-methyl-4-sulfanylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 54490139 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxybenzoyl)-1-methyl-4-sulfanylpyrrole-2-carbonitrile |
| SMILES | Cn1cc(S)c(C(=O)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c1C#N |
| InChI | InChI=1S/C21H26N2O2S/c1-20(2,3)13-8-12(9-14(19(13)25)21(4,5)6)18(24)17-15(10-22)23(7)11-16(17)26/h8-9,11,25-26H,1-7H3 |
| InChIKey | XVCTYWDBSJHXMI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|