C9H10F2N2 — CID 54492582
1-(2,4-difluorophenyl)propyldiazene (PubChem CID 54492582) has the molecular formula C9H10F2N2 and a molecular weight of 184.19 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)propyldiazene.
| Compound Name | 1-(2,4-difluorophenyl)propyldiazene |
|---|---|
| PubChem CID | 54492582 |
| Molecular Formula | C9H10F2N2 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 1-(2,4-difluorophenyl)propyldiazene |
| SMILES | [H]/N=N/C(CC)c1ccc(F)cc1F |
| InChI | InChI=1S/C9H10F2N2/c1-2-9(13-12)7-4-3-6(10)5-8(7)11/h3-5,9,12H,2H2,1H3/b13-12+ |
| InChIKey | XWTSQORDLNGRBH-OUKQBFOZSA-N |
| XLogP | 3.45 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|