C23H22ClNO6S — CID 54499299
(2S)-1-[3-acetylsulfanyl-4-[4-(4-chlorophenoxy)phenyl]-4-oxobutanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 54499299) has the molecular formula C23H22ClNO6S and a molecular weight of 475.95 g/mol. Its IUPAC name is (2S)-1-[3-acetylsulfanyl-4-[4-(4-chlorophenoxy)phenyl]-4-oxobutanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[3-acetylsulfanyl-4-[4-(4-chlorophenoxy)phenyl]-4-oxobutanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 54499299 |
| Molecular Formula | C23H22ClNO6S |
| Molecular Weight | 475.95 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | (2S)-1-[3-acetylsulfanyl-4-[4-(4-chlorophenoxy)phenyl]-4-oxobutanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(=O)SC(CC(=O)N1CCC[C@H]1C(=O)O)C(=O)c1ccc(Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H22ClNO6S/c1-14(26)32-20(13-21(27)25-12-2-3-19(25)23(29)30)22(28)15-4-8-17(9-5-15)31-18-10-6-16(24)7-11-18/h4-11,19-20H,2-3,12-13H2,1H3,(H,29,30)/t19-,20?/m0/s1 |
| InChIKey | YBHQSLRGUGJBNN-XJDOXCRVSA-N |
| XLogP | 4.43 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.95 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|