C19H19NO6S — CID 88745968
(2S)-1-[3-acetylsulfanyl-4-(2-benzofuran-1-yl)-4-oxobutanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 88745968) has the molecular formula C19H19NO6S and a molecular weight of 389.43 g/mol. Its IUPAC name is (2S)-1-[3-acetylsulfanyl-4-(2-benzofuran-1-yl)-4-oxobutanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[3-acetylsulfanyl-4-(2-benzofuran-1-yl)-4-oxobutanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 88745968 |
| Molecular Formula | C19H19NO6S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | (2S)-1-[3-acetylsulfanyl-4-(2-benzofuran-1-yl)-4-oxobutanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(=O)SC(CC(=O)N1CCC[C@H]1C(=O)O)C(=O)c1occ2ccccc12 |
| InChI | InChI=1S/C19H19NO6S/c1-11(21)27-15(9-16(22)20-8-4-7-14(20)19(24)25)17(23)18-13-6-3-2-5-12(13)10-26-18/h2-3,5-6,10,14-15H,4,7-9H2,1H3,(H,24,25)/t14-,15?/m0/s1 |
| InChIKey | UMGLNOVEKUXTGS-MLCCFXAWSA-N |
| XLogP | 2.73 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|