C14H20N4O2S — CID 54505737
methyl N'-(benzylcarbamoyl)-N-(propan-2-ylcarbamoyl)carbamimidothioate (PubChem CID 54505737) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is methyl N'-(benzylcarbamoyl)-N-(propan-2-ylcarbamoyl)carbamimidothioate.
| Compound Name | methyl N'-(benzylcarbamoyl)-N-(propan-2-ylcarbamoyl)carbamimidothioate |
|---|---|
| PubChem CID | 54505737 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | methyl N'-(benzylcarbamoyl)-N-(propan-2-ylcarbamoyl)carbamimidothioate |
| SMILES | CSC(=NC(=O)NCc1ccccc1)NC(=O)NC(C)C |
| InChI | InChI=1S/C14H20N4O2S/c1-10(2)16-13(20)18-14(21-3)17-12(19)15-9-11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3,(H3,15,16,17,18,19,20) |
| InChIKey | YFOLQTGNDFMOKJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|