C26H27NO4 — CID 54508868
benzyl (2S)-1-[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)but-2-enoyl]pyrrolidine-2-carboxylate (PubChem CID 54508868) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is benzyl (2S)-1-[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)but-2-enoyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S)-1-[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)but-2-enoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 54508868 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | benzyl (2S)-1-[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)but-2-enoyl]pyrrolidine-2-carboxylate |
| SMILES | O=C(C=CC(=O)N1CCC[C@H]1C(=O)OCc1ccccc1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C26H27NO4/c28-24(22-13-12-20-9-4-5-10-21(20)17-22)14-15-25(29)27-16-6-11-23(27)26(30)31-18-19-7-2-1-3-8-19/h1-3,7-8,12-15,17,23H,4-6,9-11,16,18H2/t23-/m0/s1 |
| InChIKey | YHRFXFPPEHNHNJ-QHCPKHFHSA-N |
| XLogP | 4.04 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|