C37H37ClN6O5 — CID 54513728
(2-chlorophenyl) 2-[2-(benzylcarbamoylamino)-7-[4-oxo-4-(1,2,3,4-tetrahydroisoquinolin-1-ylamino)butoxy]-4H-quinazolin-3-yl]acetate (PubChem CID 54513728) has the molecular formula C37H37ClN6O5 and a molecular weight of 681.19 g/mol. Its IUPAC name is (2-chlorophenyl) 2-[2-(benzylcarbamoylamino)-7-[4-oxo-4-(1,2,3,4-tetrahydroisoquinolin-1-ylamino)butoxy]-4H-quinazolin-3-yl]acetate.
| Compound Name | (2-chlorophenyl) 2-[2-(benzylcarbamoylamino)-7-[4-oxo-4-(1,2,3,4-tetrahydroisoquinolin-1-ylamino)butoxy]-4H-quinazolin-3-yl]acetate |
|---|---|
| PubChem CID | 54513728 |
| Molecular Formula | C37H37ClN6O5 |
| Molecular Weight | 681.19 g/mol |
| Exact Mass | 680.25 |
| IUPAC Name | (2-chlorophenyl) 2-[2-(benzylcarbamoylamino)-7-[4-oxo-4-(1,2,3,4-tetrahydroisoquinolin-1-ylamino)butoxy]-4H-quinazolin-3-yl]acetate |
| SMILES | O=C(CCCOc1ccc2c(c1)N=C(NC(=O)NCc1ccccc1)N(CC(=O)Oc1ccccc1Cl)C2)NC1NCCc2ccccc21 |
| InChI | InChI=1S/C37H37ClN6O5/c38-30-13-6-7-14-32(30)49-34(46)24-44-23-27-16-17-28(21-31(27)41-36(44)43-37(47)40-22-25-9-2-1-3-10-25)48-20-8-15-33(45)42-35-29-12-5-4-11-26(29)18-19-39-35/h1-7,9-14,16-17,21,35,39H,8,15,18-20,22-24H2,(H,42,45)(H2,40,41,43,47) |
| InChIKey | YKXWZUOOHBFBLK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 133.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.19 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|