C27H35N5O4 — CID 54296325
2-methylpropyl 2-[2-amino-7-[4-oxo-4-(1,2,3,4-tetrahydroquinolin-2-ylamino)butoxy]-4H-quinazolin-3-yl]acetate (PubChem CID 54296325) has the molecular formula C27H35N5O4 and a molecular weight of 493.61 g/mol. Its IUPAC name is 2-methylpropyl 2-[2-amino-7-[4-oxo-4-(1,2,3,4-tetrahydroquinolin-2-ylamino)butoxy]-4H-quinazolin-3-yl]acetate.
| Compound Name | 2-methylpropyl 2-[2-amino-7-[4-oxo-4-(1,2,3,4-tetrahydroquinolin-2-ylamino)butoxy]-4H-quinazolin-3-yl]acetate |
|---|---|
| PubChem CID | 54296325 |
| Molecular Formula | C27H35N5O4 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | 2-methylpropyl 2-[2-amino-7-[4-oxo-4-(1,2,3,4-tetrahydroquinolin-2-ylamino)butoxy]-4H-quinazolin-3-yl]acetate |
| SMILES | CC(C)COC(=O)CN1Cc2ccc(OCCCC(=O)NC3CCc4ccccc4N3)cc2N=C1N |
| InChI | InChI=1S/C27H35N5O4/c1-18(2)17-36-26(34)16-32-15-20-9-11-21(14-23(20)30-27(32)28)35-13-5-8-25(33)31-24-12-10-19-6-3-4-7-22(19)29-24/h3-4,6-7,9,11,14,18,24,29H,5,8,10,12-13,15-17H2,1-2H3,(H2,28,30)(H,31,33) |
| InChIKey | SBAKDTBWRZDGNP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|