C21H29NO3 — CID 54523687
(1R)-2-[[(2R)-1-(3,4-dimethoxyphenyl)pentan-2-yl]amino]-1-phenylethanol (PubChem CID 54523687) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is (1R)-2-[[(2R)-1-(3,4-dimethoxyphenyl)pentan-2-yl]amino]-1-phenylethanol.
| Compound Name | (1R)-2-[[(2R)-1-(3,4-dimethoxyphenyl)pentan-2-yl]amino]-1-phenylethanol |
|---|---|
| PubChem CID | 54523687 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | (1R)-2-[[(2R)-1-(3,4-dimethoxyphenyl)pentan-2-yl]amino]-1-phenylethanol |
| SMILES | CCC[C@H](Cc1ccc(OC)c(OC)c1)NC[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C21H29NO3/c1-4-8-18(22-15-19(23)17-9-6-5-7-10-17)13-16-11-12-20(24-2)21(14-16)25-3/h5-7,9-12,14,18-19,22-23H,4,8,13,15H2,1-3H3/t18-,19+/m1/s1 |
| InChIKey | YRPSFSCKHOQPQE-MOPGFXCFSA-N |
| XLogP | 3.74 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |