C28H33NO5 — CID 54537628
2-(1-adamantyloxycarbonylamino)-2-methyl-3-(4-phenylmethoxyphenyl)propanoic acid (PubChem CID 54537628) has the molecular formula C28H33NO5 and a molecular weight of 463.57 g/mol. Its IUPAC name is 2-(1-adamantyloxycarbonylamino)-2-methyl-3-(4-phenylmethoxyphenyl)propanoic acid.
| Compound Name | 2-(1-adamantyloxycarbonylamino)-2-methyl-3-(4-phenylmethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 54537628 |
| Molecular Formula | C28H33NO5 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | 2-(1-adamantyloxycarbonylamino)-2-methyl-3-(4-phenylmethoxyphenyl)propanoic acid |
| SMILES | CC(Cc1ccc(OCc2ccccc2)cc1)(NC(=O)OC12CC3CC(CC(C3)C1)C2)C(=O)O |
| InChI | InChI=1S/C28H33NO5/c1-27(25(30)31,14-19-7-9-24(10-8-19)33-18-20-5-3-2-4-6-20)29-26(32)34-28-15-21-11-22(16-28)13-23(12-21)17-28/h2-10,21-23H,11-18H2,1H3,(H,29,32)(H,30,31) |
| InChIKey | ZAXPYENUKKHXJW-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |