C9H11N3O7S — CID 54538497
3-[[2-(2,5-dihydroxypyrrol-1-yl)acetyl]amino]-2-oxoazetidine-1-sulfonic acid (PubChem CID 54538497) has the molecular formula C9H11N3O7S and a molecular weight of 305.27 g/mol. Its IUPAC name is 3-[[2-(2,5-dihydroxypyrrol-1-yl)acetyl]amino]-2-oxoazetidine-1-sulfonic acid.
| Compound Name | 3-[[2-(2,5-dihydroxypyrrol-1-yl)acetyl]amino]-2-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 54538497 |
| Molecular Formula | C9H11N3O7S |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 3-[[2-(2,5-dihydroxypyrrol-1-yl)acetyl]amino]-2-oxoazetidine-1-sulfonic acid |
| SMILES | O=C(Cn1c(O)ccc1O)NC1CN(S(=O)(=O)O)C1=O |
| InChI | InChI=1S/C9H11N3O7S/c13-6(4-11-7(14)1-2-8(11)15)10-5-3-12(9(5)16)20(17,18)19/h1-2,5,14-15H,3-4H2,(H,10,13)(H,17,18,19) |
| InChIKey | ZBLPXDYHARHWHI-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 149.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|