C17H27N5O6 — CID 91370869
N-[2-[3-(2,5-dihydroxypyrrol-1-yl)propanoylamino]ethyl]-2,6-diformamidohexanamide (PubChem CID 91370869) has the molecular formula C17H27N5O6 and a molecular weight of 397.43 g/mol. Its IUPAC name is N-[2-[3-(2,5-dihydroxypyrrol-1-yl)propanoylamino]ethyl]-2,6-diformamidohexanamide.
| Compound Name | N-[2-[3-(2,5-dihydroxypyrrol-1-yl)propanoylamino]ethyl]-2,6-diformamidohexanamide |
|---|---|
| PubChem CID | 91370869 |
| Molecular Formula | C17H27N5O6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | N-[2-[3-(2,5-dihydroxypyrrol-1-yl)propanoylamino]ethyl]-2,6-diformamidohexanamide |
| SMILES | O=CNCCCCC(NC=O)C(=O)NCCNC(=O)CCn1c(O)ccc1O |
| InChI | InChI=1S/C17H27N5O6/c23-11-18-7-2-1-3-13(21-12-24)17(28)20-9-8-19-14(25)6-10-22-15(26)4-5-16(22)27/h4-5,11-13,26-27H,1-3,6-10H2,(H,18,23)(H,19,25)(H,20,28)(H,21,24) |
| InChIKey | QWAHEPFVHREFAS-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 161.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|