C20H39FO2S — CID 54541384
2,2,3,3-tetrabutyl-4-fluorothiolane 1,1-dioxide (PubChem CID 54541384) has the molecular formula C20H39FO2S and a molecular weight of 362.60 g/mol. Its IUPAC name is 2,2,3,3-tetrabutyl-4-fluorothiolane 1,1-dioxide.
| Compound Name | 2,2,3,3-tetrabutyl-4-fluorothiolane 1,1-dioxide |
|---|---|
| PubChem CID | 54541384 |
| Molecular Formula | C20H39FO2S |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | 2,2,3,3-tetrabutyl-4-fluorothiolane 1,1-dioxide |
| SMILES | CCCCC1(CCCC)C(F)CS(=O)(=O)C1(CCCC)CCCC |
| InChI | InChI=1S/C20H39FO2S/c1-5-9-13-19(14-10-6-2)18(21)17-24(22,23)20(19,15-11-7-3)16-12-8-4/h18H,5-17H2,1-4H3 |
| InChIKey | ZDKXVLGIIXCLCE-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |