C43H77N3O8S — CID 54542564
27-methylperoxyheptacosane-3,9,15,21-tetrone;5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-pentylpentanamide (PubChem CID 54542564) has the molecular formula C43H77N3O8S and a molecular weight of 796.17 g/mol. Its IUPAC name is 27-methylperoxyheptacosane-3,9,15,21-tetrone;5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-pentylpentanamide.
| Compound Name | 27-methylperoxyheptacosane-3,9,15,21-tetrone;5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-pentylpentanamide |
|---|---|
| PubChem CID | 54542564 |
| Molecular Formula | C43H77N3O8S |
| Molecular Weight | 796.17 g/mol |
| Exact Mass | 795.54 |
| IUPAC Name | 27-methylperoxyheptacosane-3,9,15,21-tetrone;5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-pentylpentanamide |
| SMILES | CCC(=O)CCCCCC(=O)CCCCCC(=O)CCCCCC(=O)CCCCCCOOC.CCCCCNC(=O)CCCCC1SCC2NC(=O)NC21 |
| InChI | InChI=1S/C28H50O6.C15H27N3O2S/c1-3-25(29)17-10-6-11-19-27(31)21-14-8-15-23-28(32)22-13-7-12-20-26(30)18-9-4-5-16-24-34-33-2;1-2-3-6-9-16-13(19)8-5-4-7-12-14-11(10-21-12)17-15(20)18-14/h3-24H2,1-2H3;11-12,14H,2-10H2,1H3,(H,16,19)(H2,17,18,20) |
| InChIKey | ZEGMBRNVMMLTSO-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 156.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.17 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|