C15H28O2 — CID 54545541
2-(3-hydroxyhex-1-enyl)-1,3,3-trimethylcyclohexan-1-ol (PubChem CID 54545541) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-(3-hydroxyhex-1-enyl)-1,3,3-trimethylcyclohexan-1-ol.
| Compound Name | 2-(3-hydroxyhex-1-enyl)-1,3,3-trimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 54545541 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 2-(3-hydroxyhex-1-enyl)-1,3,3-trimethylcyclohexan-1-ol |
| SMILES | CCCC(O)C=CC1C(C)(C)CCCC1(C)O |
| InChI | InChI=1S/C15H28O2/c1-5-7-12(16)8-9-13-14(2,3)10-6-11-15(13,4)17/h8-9,12-13,16-17H,5-7,10-11H2,1-4H3 |
| InChIKey | ZGHHRYZEVKEXRM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|