C20H19N5O3S — CID 54548115
(2R,3R,4S,5S)-2-(6-amino-2-naphthalen-1-ylpurin-9-yl)-5-(sulfanylmethyl)oxolane-3,4-diol (PubChem CID 54548115) has the molecular formula C20H19N5O3S and a molecular weight of 409.47 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(6-amino-2-naphthalen-1-ylpurin-9-yl)-5-(sulfanylmethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(6-amino-2-naphthalen-1-ylpurin-9-yl)-5-(sulfanylmethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 54548115 |
| Molecular Formula | C20H19N5O3S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | (2R,3R,4S,5S)-2-(6-amino-2-naphthalen-1-ylpurin-9-yl)-5-(sulfanylmethyl)oxolane-3,4-diol |
| SMILES | Nc1nc(-c2cccc3ccccc23)nc2c1ncn2[C@@H]1O[C@H](CS)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H19N5O3S/c21-17-14-19(25(9-22-14)20-16(27)15(26)13(8-29)28-20)24-18(23-17)12-7-3-5-10-4-1-2-6-11(10)12/h1-7,9,13,15-16,20,26-27,29H,8H2,(H2,21,23,24)/t13-,15-,16-,20-/m1/s1 |
| InChIKey | ZHZRBSZVVXPANA-KHTYJDQRSA-N |
| XLogP | 1.78 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|