C28H21F3N2O6S — CID 54557401
4-[3-(1H-benzimidazol-1-ium-2-ylsulfanylmethyl)-5-(3-methoxyphenyl)furan-2-yl]benzoic acid;2,2,2-trifluoroacetate (PubChem CID 54557401) has the molecular formula C28H21F3N2O6S and a molecular weight of 570.55 g/mol. Its IUPAC name is 4-[3-(1H-benzimidazol-1-ium-2-ylsulfanylmethyl)-5-(3-methoxyphenyl)furan-2-yl]benzoic acid;2,2,2-trifluoroacetate.
| Compound Name | 4-[3-(1H-benzimidazol-1-ium-2-ylsulfanylmethyl)-5-(3-methoxyphenyl)furan-2-yl]benzoic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 54557401 |
| Molecular Formula | C28H21F3N2O6S |
| Molecular Weight | 570.55 g/mol |
| Exact Mass | 570.11 |
| IUPAC Name | 4-[3-(1H-benzimidazol-1-ium-2-ylsulfanylmethyl)-5-(3-methoxyphenyl)furan-2-yl]benzoic acid;2,2,2-trifluoroacetate |
| SMILES | COc1cccc(-c2cc(CSC3=Nc4ccccc4[NH2+]3)c(-c3ccc(C(=O)O)cc3)o2)c1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C26H20N2O4S.C2HF3O2/c1-31-20-6-4-5-18(13-20)23-14-19(15-33-26-27-21-7-2-3-8-22(21)28-26)24(32-23)16-9-11-17(12-10-16)25(29)30;3-2(4,5)1(6)7/h2-14H,15H2,1H3,(H,27,28)(H,29,30);(H,6,7) |
| InChIKey | ZODAWABAQCUTCW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 128.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.55 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|