C18H11F3N2O5 — CID 132604858
[5-(3-methoxyphenyl)-2-(trifluoromethyl)-1,3-oxazol-4-yl]-(4-nitrophenyl)methanone (PubChem CID 132604858) has the molecular formula C18H11F3N2O5 and a molecular weight of 392.29 g/mol. Its IUPAC name is [5-(3-methoxyphenyl)-2-(trifluoromethyl)-1,3-oxazol-4-yl]-(4-nitrophenyl)methanone.
| Compound Name | [5-(3-methoxyphenyl)-2-(trifluoromethyl)-1,3-oxazol-4-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 132604858 |
| Molecular Formula | C18H11F3N2O5 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | [5-(3-methoxyphenyl)-2-(trifluoromethyl)-1,3-oxazol-4-yl]-(4-nitrophenyl)methanone |
| SMILES | COc1cccc(-c2oc(C(F)(F)F)nc2C(=O)c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C18H11F3N2O5/c1-27-13-4-2-3-11(9-13)16-14(22-17(28-16)18(19,20)21)15(24)10-5-7-12(8-6-10)23(25)26/h2-9H,1H3 |
| InChIKey | LRTDTXUESUYXSA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|