C12H11F3OS — CID 54574474
2,2-dimethyl-3-(trifluoromethylsulfanyl)chromene (PubChem CID 54574474) has the molecular formula C12H11F3OS and a molecular weight of 260.28 g/mol. Its IUPAC name is 2,2-dimethyl-3-(trifluoromethylsulfanyl)chromene.
| Compound Name | 2,2-dimethyl-3-(trifluoromethylsulfanyl)chromene |
|---|---|
| PubChem CID | 54574474 |
| Molecular Formula | C12H11F3OS |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 2,2-dimethyl-3-(trifluoromethylsulfanyl)chromene |
| SMILES | CC1(C)Oc2ccccc2C=C1SC(F)(F)F |
| InChI | InChI=1S/C12H11F3OS/c1-11(2)10(17-12(13,14)15)7-8-5-3-4-6-9(8)16-11/h3-7H,1-2H3 |
| InChIKey | ZZOZJENFPAGZLG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |