C7H17ClNSi- — CID 54576542
1,1-dimethylsilinan-4-amine chloride (PubChem CID 54576542) has the molecular formula C7H17ClNSi- and a molecular weight of 178.76 g/mol. Its IUPAC name is 1,1-dimethylsilinan-4-amine chloride.
| Compound Name | 1,1-dimethylsilinan-4-amine chloride |
|---|---|
| PubChem CID | 54576542 |
| Molecular Formula | C7H17ClNSi- |
| Molecular Weight | 178.76 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 1,1-dimethylsilinan-4-amine chloride |
| SMILES | C[Si]1(C)CCC(N)CC1.[Cl-] |
| InChI | InChI=1S/C7H17NSi.ClH/c1-9(2)5-3-7(8)4-6-9;/h7H,3-6,8H2,1-2H3;1H/p-1 |
| InChIKey | CKXDEORVRZVCBR-UHFFFAOYSA-M |
| XLogP | -1.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.76 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|