C27H40N2O4 — CID 54588089
[3-[6-[(dimethylamino)methyl]cyclohexen-1-yl]phenyl] 2-[1-[(ethoxycarbonylamino)methyl]cyclohexyl]acetate (PubChem CID 54588089) has the molecular formula C27H40N2O4 and a molecular weight of 456.63 g/mol. Its IUPAC name is [3-[6-[(dimethylamino)methyl]cyclohexen-1-yl]phenyl] 2-[1-[(ethoxycarbonylamino)methyl]cyclohexyl]acetate.
| Compound Name | [3-[6-[(dimethylamino)methyl]cyclohexen-1-yl]phenyl] 2-[1-[(ethoxycarbonylamino)methyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 54588089 |
| Molecular Formula | C27H40N2O4 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.30 |
| IUPAC Name | [3-[6-[(dimethylamino)methyl]cyclohexen-1-yl]phenyl] 2-[1-[(ethoxycarbonylamino)methyl]cyclohexyl]acetate |
| SMILES | CCOC(=O)NCC1(CC(=O)Oc2cccc(C3=CCCCC3CN(C)C)c2)CCCCC1 |
| InChI | InChI=1S/C27H40N2O4/c1-4-32-26(31)28-20-27(15-8-5-9-16-27)18-25(30)33-23-13-10-12-21(17-23)24-14-7-6-11-22(24)19-29(2)3/h10,12-14,17,22H,4-9,11,15-16,18-20H2,1-3H3,(H,28,31) |
| InChIKey | YPYLLWWOBQLXSQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|