C47H62O7 — CID 54589693
(2R,3R,4S,5S,6S)-6-methoxy-4,5-bis(phenylmethoxy)-2-(2-phenylmethoxyethyl)-6-[(2R)-2-phenylmethoxyundecyl]oxan-3-ol (PubChem CID 54589693) has the molecular formula C47H62O7 and a molecular weight of 739.01 g/mol. Its IUPAC name is (2R,3R,4S,5S,6S)-6-methoxy-4,5-bis(phenylmethoxy)-2-(2-phenylmethoxyethyl)-6-[(2R)-2-phenylmethoxyundecyl]oxan-3-ol.
| Compound Name | (2R,3R,4S,5S,6S)-6-methoxy-4,5-bis(phenylmethoxy)-2-(2-phenylmethoxyethyl)-6-[(2R)-2-phenylmethoxyundecyl]oxan-3-ol |
|---|---|
| PubChem CID | 54589693 |
| Molecular Formula | C47H62O7 |
| Molecular Weight | 739.01 g/mol |
| Exact Mass | 738.45 |
| IUPAC Name | (2R,3R,4S,5S,6S)-6-methoxy-4,5-bis(phenylmethoxy)-2-(2-phenylmethoxyethyl)-6-[(2R)-2-phenylmethoxyundecyl]oxan-3-ol |
| SMILES | CCCCCCCCC[C@H](C[C@]1(OC)O[C@H](CCOCc2ccccc2)[C@@H](O)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C47H62O7/c1-3-4-5-6-7-8-21-30-42(51-35-39-24-15-10-16-25-39)33-47(49-2)46(53-37-41-28-19-12-20-29-41)45(52-36-40-26-17-11-18-27-40)44(48)43(54-47)31-32-50-34-38-22-13-9-14-23-38/h9-20,22-29,42-46,48H,3-8,21,30-37H2,1-2H3/t42-,43-,44-,45+,46+,47+/m1/s1 |
| InChIKey | RKHKYQNEIACDJY-JWMPASCYSA-N |
| XLogP | 9.98 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.01 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|