C49H58N4O4 — CID 54590164
(2R,3R,4R,5S)-1-[2-[1-(1-adamantylmethyl)triazol-4-yl]ethyl]-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine (PubChem CID 54590164) has the molecular formula C49H58N4O4 and a molecular weight of 767.03 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[2-[1-(1-adamantylmethyl)triazol-4-yl]ethyl]-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine.
| Compound Name | (2R,3R,4R,5S)-1-[2-[1-(1-adamantylmethyl)triazol-4-yl]ethyl]-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine |
|---|---|
| PubChem CID | 54590164 |
| Molecular Formula | C49H58N4O4 |
| Molecular Weight | 767.03 g/mol |
| Exact Mass | 766.45 |
| IUPAC Name | (2R,3R,4R,5S)-1-[2-[1-(1-adamantylmethyl)triazol-4-yl]ethyl]-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine |
| SMILES | c1ccc(COC[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)CN2CCc2cn(CC34CC5CC(CC(C5)C3)C4)nn2)cc1 |
| InChI | InChI=1S/C49H58N4O4/c1-5-13-37(14-6-1)31-54-35-45-47(56-33-39-17-9-3-10-18-39)48(57-34-40-19-11-4-12-20-40)46(55-32-38-15-7-2-8-16-38)30-52(45)22-21-44-29-53(51-50-44)36-49-26-41-23-42(27-49)25-43(24-41)28-49/h1-20,29,41-43,45-48H,21-28,30-36H2/t41?,42?,43?,45-,46+,47-,48-,49?/m1/s1 |
| InChIKey | VWTPIWSSTPSRGO-BMRYTFJESA-N |
| XLogP | 8.69 |
| TPSA | 70.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.03 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |