C56H64N4O5 — CID 54753557
(2R,3R,4R,5S)-1-[3-[4-[[4-(1-adamantyl)phenoxy]methyl]triazol-1-yl]propyl]-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine (PubChem CID 54753557) has the molecular formula C56H64N4O5 and a molecular weight of 873.15 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[3-[4-[[4-(1-adamantyl)phenoxy]methyl]triazol-1-yl]propyl]-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine.
| Compound Name | (2R,3R,4R,5S)-1-[3-[4-[[4-(1-adamantyl)phenoxy]methyl]triazol-1-yl]propyl]-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine |
|---|---|
| PubChem CID | 54753557 |
| Molecular Formula | C56H64N4O5 |
| Molecular Weight | 873.15 g/mol |
| Exact Mass | 872.49 |
| IUPAC Name | (2R,3R,4R,5S)-1-[3-[4-[[4-(1-adamantyl)phenoxy]methyl]triazol-1-yl]propyl]-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidine |
| SMILES | c1ccc(COC[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)CN2CCCn2cc(COc3ccc(C45CC6CC(CC(C6)C4)C5)cc3)nn2)cc1 |
| InChI | InChI=1S/C56H64N4O5/c1-5-14-42(15-6-1)36-61-41-52-54(64-38-44-18-9-3-10-19-44)55(65-39-45-20-11-4-12-21-45)53(63-37-43-16-7-2-8-17-43)35-59(52)26-13-27-60-34-50(57-58-60)40-62-51-24-22-49(23-25-51)56-31-46-28-47(32-56)30-48(29-46)33-56/h1-12,14-25,34,46-48,52-55H,13,26-33,35-41H2/t46?,47?,48?,52-,53+,54-,55-,56?/m1/s1 |
| InChIKey | VDGWNQWBBYYJCP-MSQQNHOGSA-N |
| XLogP | 10.37 |
| TPSA | 80.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.15 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |