C45H54N4O5 — CID 54753025
1-[1-[3-[(2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidin-1-yl]propyl]triazol-4-yl]cyclohexan-1-ol (PubChem CID 54753025) has the molecular formula C45H54N4O5 and a molecular weight of 730.95 g/mol. Its IUPAC name is 1-[1-[3-[(2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidin-1-yl]propyl]triazol-4-yl]cyclohexan-1-ol.
| Compound Name | 1-[1-[3-[(2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidin-1-yl]propyl]triazol-4-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 54753025 |
| Molecular Formula | C45H54N4O5 |
| Molecular Weight | 730.95 g/mol |
| Exact Mass | 730.41 |
| IUPAC Name | 1-[1-[3-[(2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)piperidin-1-yl]propyl]triazol-4-yl]cyclohexan-1-ol |
| SMILES | OC1(c2cn(CCCN3C[C@H](OCc4ccccc4)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3COCc3ccccc3)nn2)CCCCC1 |
| InChI | InChI=1S/C45H54N4O5/c50-45(25-14-5-15-26-45)42-30-49(47-46-42)28-16-27-48-29-41(52-32-37-19-8-2-9-20-37)44(54-34-39-23-12-4-13-24-39)43(53-33-38-21-10-3-11-22-38)40(48)35-51-31-36-17-6-1-7-18-36/h1-4,6-13,17-24,30,40-41,43-44,50H,5,14-16,25-29,31-35H2/t40-,41+,43-,44-/m1/s1 |
| InChIKey | OPOYLWURJNVMQO-RNULKTODSA-N |
| XLogP | 7.48 |
| TPSA | 91.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.95 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |