C14H8F2O3 — CID 54590961
2-(3,5-difluorophenyl)-1-benzofuran-4,6-diol (PubChem CID 54590961) has the molecular formula C14H8F2O3 and a molecular weight of 262.21 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-1-benzofuran-4,6-diol.
| Compound Name | 2-(3,5-difluorophenyl)-1-benzofuran-4,6-diol |
|---|---|
| PubChem CID | 54590961 |
| Molecular Formula | C14H8F2O3 |
| Molecular Weight | 262.21 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 2-(3,5-difluorophenyl)-1-benzofuran-4,6-diol |
| SMILES | Oc1cc(O)c2cc(-c3cc(F)cc(F)c3)oc2c1 |
| InChI | InChI=1S/C14H8F2O3/c15-8-1-7(2-9(16)3-8)13-6-11-12(18)4-10(17)5-14(11)19-13/h1-6,17-18H |
| InChIKey | GCPGLUQKUXJBLD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.21 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |