C14H9FO3 — CID 54590959
2-(4-fluorophenyl)-1-benzofuran-4,6-diol (PubChem CID 54590959) has the molecular formula C14H9FO3 and a molecular weight of 244.22 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-benzofuran-4,6-diol.
| Compound Name | 2-(4-fluorophenyl)-1-benzofuran-4,6-diol |
|---|---|
| PubChem CID | 54590959 |
| Molecular Formula | C14H9FO3 |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 2-(4-fluorophenyl)-1-benzofuran-4,6-diol |
| SMILES | Oc1cc(O)c2cc(-c3ccc(F)cc3)oc2c1 |
| InChI | InChI=1S/C14H9FO3/c15-9-3-1-8(2-4-9)13-7-11-12(17)5-10(16)6-14(11)18-13/h1-7,16-17H |
| InChIKey | CEHNXEQBDAQILS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |