C24H23Cl — CID 54597344
1-[4,4-bis(4-methylphenyl)but-3-en-2-yl]-4-chlorobenzene (PubChem CID 54597344) has the molecular formula C24H23Cl and a molecular weight of 346.90 g/mol. Its IUPAC name is 1-[4,4-bis(4-methylphenyl)but-3-en-2-yl]-4-chlorobenzene.
| Compound Name | 1-[4,4-bis(4-methylphenyl)but-3-en-2-yl]-4-chlorobenzene |
|---|---|
| PubChem CID | 54597344 |
| Molecular Formula | C24H23Cl |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1-[4,4-bis(4-methylphenyl)but-3-en-2-yl]-4-chlorobenzene |
| SMILES | Cc1ccc(C(=CC(C)c2ccc(Cl)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H23Cl/c1-17-4-8-21(9-5-17)24(22-10-6-18(2)7-11-22)16-19(3)20-12-14-23(25)15-13-20/h4-16,19H,1-3H3 |
| InChIKey | XMHYPBMYQNLXPN-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |