C9H20N8 — CID 54599915
1-[(Z)-[(1E)-1-[(N,N'-dimethylcarbamimidoyl)hydrazinylidene]propan-2-ylidene]amino]-2,3-dimethylguanidine (PubChem CID 54599915) has the molecular formula C9H20N8 and a molecular weight of 240.31 g/mol. Its IUPAC name is 1-[(Z)-[(1E)-1-[(N,N'-dimethylcarbamimidoyl)hydrazinylidene]propan-2-ylidene]amino]-2,3-dimethylguanidine.
| Compound Name | 1-[(Z)-[(1E)-1-[(N,N'-dimethylcarbamimidoyl)hydrazinylidene]propan-2-ylidene]amino]-2,3-dimethylguanidine |
|---|---|
| PubChem CID | 54599915 |
| Molecular Formula | C9H20N8 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | 1-[(Z)-[(1E)-1-[(N,N'-dimethylcarbamimidoyl)hydrazinylidene]propan-2-ylidene]amino]-2,3-dimethylguanidine |
| SMILES | C/N=C(\NC)N/N=C(C)\C=N\N/C(=N/C)NC |
| InChI | InChI=1S/C9H20N8/c1-7(15-17-9(12-4)13-5)6-14-16-8(10-2)11-3/h6H,1-5H3,(H2,10,11,16)(H2,12,13,17)/b14-6+,15-7- |
| InChIKey | FUECJBPKFFLGGS-QSPLRUFESA-N |
| XLogP | -1.06 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|