C19H19ClF3N5O2 — CID 54603167
N-[(E)-[2-chloro-4-(dimethylamino)phenyl]methylideneamino]-2-[[3-(trifluoromethyl)phenyl]carbamoylamino]acetamide (PubChem CID 54603167) has the molecular formula C19H19ClF3N5O2 and a molecular weight of 441.84 g/mol. Its IUPAC name is N-[(E)-[2-chloro-4-(dimethylamino)phenyl]methylideneamino]-2-[[3-(trifluoromethyl)phenyl]carbamoylamino]acetamide.
| Compound Name | N-[(E)-[2-chloro-4-(dimethylamino)phenyl]methylideneamino]-2-[[3-(trifluoromethyl)phenyl]carbamoylamino]acetamide |
|---|---|
| PubChem CID | 54603167 |
| Molecular Formula | C19H19ClF3N5O2 |
| Molecular Weight | 441.84 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | N-[(E)-[2-chloro-4-(dimethylamino)phenyl]methylideneamino]-2-[[3-(trifluoromethyl)phenyl]carbamoylamino]acetamide |
| SMILES | CN(C)c1ccc(/C=N/NC(=O)CNC(=O)Nc2cccc(C(F)(F)F)c2)c(Cl)c1 |
| InChI | InChI=1S/C19H19ClF3N5O2/c1-28(2)15-7-6-12(16(20)9-15)10-25-27-17(29)11-24-18(30)26-14-5-3-4-13(8-14)19(21,22)23/h3-10H,11H2,1-2H3,(H,27,29)(H2,24,26,30)/b25-10+ |
| InChIKey | ZRKQFLZLICTBCK-KIBLKLHPSA-N |
| XLogP | 3.70 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.84 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|