C19H24N4O5 — CID 54606097
N-[(E)-[2-(4-methoxycyclohexyl)cyclohex-2-en-1-ylidene]amino]-2,4-dinitroaniline (PubChem CID 54606097) has the molecular formula C19H24N4O5 and a molecular weight of 388.42 g/mol. Its IUPAC name is N-[(E)-[2-(4-methoxycyclohexyl)cyclohex-2-en-1-ylidene]amino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-[2-(4-methoxycyclohexyl)cyclohex-2-en-1-ylidene]amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 54606097 |
| Molecular Formula | C19H24N4O5 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | N-[(E)-[2-(4-methoxycyclohexyl)cyclohex-2-en-1-ylidene]amino]-2,4-dinitroaniline |
| SMILES | COC1CCC(C2=CCCC/C2=N\Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H24N4O5/c1-28-15-9-6-13(7-10-15)16-4-2-3-5-17(16)20-21-18-11-8-14(22(24)25)12-19(18)23(26)27/h4,8,11-13,15,21H,2-3,5-7,9-10H2,1H3/b20-17+ |
| InChIKey | AGUCEBSYFJUASO-LVZFUZTISA-N |
| XLogP | 4.59 |
| TPSA | 119.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|