C37H42N2O8Si — CID 5461231
[2-[[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-(2-methoxy-3-nitrophenyl)ethyl]-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl] acetate (PubChem CID 5461231) has the molecular formula C37H42N2O8Si and a molecular weight of 670.84 g/mol. Its IUPAC name is [2-[[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-(2-methoxy-3-nitrophenyl)ethyl]-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl] acetate.
| Compound Name | [2-[[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-(2-methoxy-3-nitrophenyl)ethyl]-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 5461231 |
| Molecular Formula | C37H42N2O8Si |
| Molecular Weight | 670.84 g/mol |
| Exact Mass | 670.27 |
| IUPAC Name | [2-[[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-(2-methoxy-3-nitrophenyl)ethyl]-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl] acetate |
| SMILES | COc1ccc(CN(C(=O)COC(C)=O)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c2cccc([N+](=O)[O-])c2OC)cc1 |
| InChI | InChI=1S/C37H42N2O8Si/c1-27(40)46-26-35(41)38(24-28-20-22-29(44-5)23-21-28)34(32-18-13-19-33(39(42)43)36(32)45-6)25-47-48(37(2,3)4,30-14-9-7-10-15-30)31-16-11-8-12-17-31/h7-23,34H,24-26H2,1-6H3/t34-/m0/s1 |
| InChIKey | VUNJIYSJPCQZTA-UMSFTDKQSA-N |
| XLogP | 5.82 |
| TPSA | 117.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.84 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|