C23H21N5O8 — CID 5465006
(4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]-6-(furan-2-yl)-N-(4-methoxyphenyl)-6-oxohexanamide (PubChem CID 5465006) has the molecular formula C23H21N5O8 and a molecular weight of 495.45 g/mol. Its IUPAC name is (4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]-6-(furan-2-yl)-N-(4-methoxyphenyl)-6-oxohexanamide.
| Compound Name | (4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]-6-(furan-2-yl)-N-(4-methoxyphenyl)-6-oxohexanamide |
|---|---|
| PubChem CID | 5465006 |
| Molecular Formula | C23H21N5O8 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | (4Z)-4-[(2,4-dinitrophenyl)hydrazinylidene]-6-(furan-2-yl)-N-(4-methoxyphenyl)-6-oxohexanamide |
| SMILES | COc1ccc(NC(=O)CC/C(CC(=O)c2ccco2)=N/Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H21N5O8/c1-35-18-8-4-15(5-9-18)24-23(30)11-6-16(13-21(29)22-3-2-12-36-22)25-26-19-10-7-17(27(31)32)14-20(19)28(33)34/h2-5,7-10,12,14,26H,6,11,13H2,1H3,(H,24,30)/b25-16- |
| InChIKey | VBTCEGMIRORDEZ-XYGWBWBKSA-N |
| XLogP | 4.56 |
| TPSA | 179.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|